CAS 4818-59-1 appears in our catalog under these names: Furosemide EP Impurity A, Iso Furosemide, 2-Chloro-4-((furan-2-ylmethyl)amino)-5-sulphamoylbenzoic Acid, IsoFurosemide, FUROSEMIDE IMPURITY A. Offered by: Chemat Brand, TRC, Mikromol, Biosynth, Sigma-Aldrich. Available pack sizes: on request, 100mg, 10mg, 50mg, 25mg, 1EA.
2-chloro-4-(furan-2-ylmethylamino)-5-sulfamoylbenzoic acid (CAS 4818-59-1) is a chemical compound with the molecular formula C12H11ClN2O5S and a molecular weight of 330.74 g/mol. IUPAC name: 2-chloro-4-(furan-2-ylmethylamino)-5-sulfamoylbenzoic acid. InChIKey: UXOOVYKVEXGCSH-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O5S |
|---|---|
| Molecular weight | 330.74 g/mol |
| IUPAC name | 2-chloro-4-(furan-2-ylmethylamino)-5-sulfamoylbenzoic acid |
| InChIKey | UXOOVYKVEXGCSH-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)CNC2=C(C=C(C(=C2)Cl)C(=O)O)S(=O)(=O)N |
Computed by PubChem (NCBI)