Products 22900-11-4
CAS 22900-11-4 appears in our catalog under these names: N-Acetylneuraminic acid methyl ester, 10 g, N-Acetylneuraminic Acid Methyl Ester, N-Acetylneuraminic Acid Methyl Ester, >95.0%(HPLC), N-Acetylneuraminic acid methyl ester, 5 g, N-Acetylneuraminic acid methyl ester, 25 g. Offered by: Roth, TRC, TCI, Chemat, MedChemExpress. Available pack sizes: 10g, 100mg, 2,5g, 250mg, 1g, 2g, 5g, 25g.
Methyl (2S,4S,5R,6R)-5-acetamido-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate (CAS 22900-11-4) is a chemical compound with the molecular formula C12H21NO9 and a molecular weight of 323.30 g/mol. IUPAC name: methyl (2S,4S,5R,6R)-5-acetamido-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate. InChIKey: BKZQMWNJESHHSA-AGNBLMTLSA-N.
| Molecular formula | C12H21NO9 |
|---|---|
| Molecular weight | 323.30 g/mol |
| IUPAC name | methyl (2S,4S,5R,6R)-5-acetamido-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
| InChIKey | BKZQMWNJESHHSA-AGNBLMTLSA-N |
| SMILES | CC(=O)N[C@@H]1[C@H](C[C@](O[C@H]1[C@@H]([C@@H](CO)O)O)(C(=O)OC)O)O |
Computed by PubChem (NCBI)
Synonyms:
beta-Neuraminic acid, N-acetyl-, methyl ester, N-Acetylneuraminic acid methyl ester, N-Acetyl-D-neuraminic acid methyl ester, N-Acet, |_-Neuraminic acid, N-acetyl-, methyl ester, |A-Neuraminic acid, N-acetyl-, methyl ester, Methyl 5-acetamido-3,5-dideoxy-D-glycero-beta-D-galacto-non-2-ulopyranosonate