CAS 32766-94-2 is the registry number for N-acetylneuraminic acid methyl ester, 98%. Offered by: AmBeed. Available pack sizes: 25g.
Methyl N-acetylneuraminate is the carbohydrate acid ester that is the methyl ester of N-acetylneuraminic acid. It is functionally related to a N-acetylneuraminic acid.
Source: ChEBI
| Molecular formula | C12H21NO9 |
|---|---|
| Molecular weight | 323.30 g/mol |
| IUPAC name | methyl (4S,5R,6R)-5-acetamido-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
| InChIKey | BKZQMWNJESHHSA-PQYSTZNASA-N |
| SMILES | CC(=O)N[C@@H]1[C@H](CC(O[C@H]1[C@@H]([C@@H](CO)O)O)(C(=O)OC)O)O |
Computed by PubChem (NCBI)