CAS 229185-00-6 is the registry number for (1S,2S)-1-(Naphthalen-1-yl)-2-(naphthalen-2-yl)ethane-1,2-diol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,2S)-1-naphthalen-1-yl-2-naphthalen-2-ylethane-1,2-diol (CAS 229185-00-6) is a chemical compound with the molecular formula C22H18O2 and a molecular weight of 314.4 g/mol. IUPAC name: (1S,2S)-1-naphthalen-1-yl-2-naphthalen-2-ylethane-1,2-diol. InChIKey: RSFIBRKJSPSKFZ-VXKWHMMOSA-N.
| Molecular formula | C22H18O2 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | (1S,2S)-1-naphthalen-1-yl-2-naphthalen-2-ylethane-1,2-diol |
| InChIKey | RSFIBRKJSPSKFZ-VXKWHMMOSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)[C@@H]([C@H](C3=CC=CC4=CC=CC=C43)O)O |
Computed by PubChem (NCBI)