CAS 76373-23-4 appears in our catalog under these names: (S)-[1,1'-Binaphthalene]-2,2'-diyldimethanol 97%, (S)-[1,1'-Binaphthalene]-2,2'-diyldimethanol, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
[1-[2-(hydroxymethyl)naphthalen-1-yl]naphthalen-2-yl]methanol (CAS 76373-23-4) is a chemical compound with the molecular formula C22H18O2 and a molecular weight of 314.4 g/mol. IUPAC name: [1-[2-(hydroxymethyl)naphthalen-1-yl]naphthalen-2-yl]methanol. InChIKey: MBKVMGGUKWIVDS-UHFFFAOYSA-N.
| Molecular formula | C22H18O2 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | [1-[2-(hydroxymethyl)naphthalen-1-yl]naphthalen-2-yl]methanol |
| InChIKey | MBKVMGGUKWIVDS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)CO)CO |
Computed by PubChem (NCBI)