CAS 229343-30-0 is the registry number for 2-Amino-5-chloro-N-(5-chloropyridin-2-yl)benzamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-5-chloro-N-(5-chloro-2-pyridinyl)benzamide (CAS 229343-30-0) is a chemical compound with the molecular formula C12H9Cl2N3O and a molecular weight of 282.12 g/mol. IUPAC name: 2-amino-5-chloro-N-(5-chloro-2-pyridinyl)benzamide. InChIKey: ODRSBTUNOBGADL-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2N3O |
|---|---|
| Molecular weight | 282.12 g/mol |
| IUPAC name | 2-amino-5-chloro-N-(5-chloro-2-pyridinyl)benzamide |
| InChIKey | ODRSBTUNOBGADL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)NC2=NC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)