CAS 631914-68-6 is the registry number for N-((3,6-Dichloropyridazin-4-yl)methyl)benzamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
N-[(3,6-dichloropyridazin-4-yl)methyl]benzamide (CAS 631914-68-6) is a chemical compound with the molecular formula C12H9Cl2N3O and a molecular weight of 282.12 g/mol. IUPAC name: N-[(3,6-dichloropyridazin-4-yl)methyl]benzamide. InChIKey: QSZUORYTZQQAGL-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2N3O |
|---|---|
| Molecular weight | 282.12 g/mol |
| IUPAC name | N-[(3,6-dichloropyridazin-4-yl)methyl]benzamide |
| InChIKey | QSZUORYTZQQAGL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NCC2=CC(=NN=C2Cl)Cl |
Computed by PubChem (NCBI)