Products 2293907-62-5
CAS 2293907-62-5 is the registry number for 3-Bromo-2-fluoro-N-methoxy-N,5-dimethylbenzamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-bromo-2-fluoro-N-methoxy-N,5-dimethylbenzamide (CAS 2293907-62-5) is a chemical compound with the molecular formula C10H11BrFNO2 and a molecular weight of 276.10 g/mol. IUPAC name: 3-bromo-2-fluoro-N-methoxy-N,5-dimethylbenzamide. InChIKey: SZOIOGPBXDGWLI-UHFFFAOYSA-N.
| Molecular formula | C10H11BrFNO2 |
|---|---|
| Molecular weight | 276.10 g/mol |
| IUPAC name | 3-bromo-2-fluoro-N-methoxy-N,5-dimethylbenzamide |
| InChIKey | SZOIOGPBXDGWLI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Br)F)C(=O)N(C)OC |
Computed by PubChem (NCBI)