Products 2412947-15-8

CAS 2412947-15-8 is the registry number for sRANKL–IN–3. Offered by: GLPBio. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg.

Structural formula: {0} (CAS {1})

2-[[3-hydroxy-1-oxo-1-(pyridin-2-ylamino)but-2-en-2-yl]diazenyl]benzoic acid (CAS 2412947-15-8) is a chemical compound with the molecular formula C16H14N4O4 and a molecular weight of 326.31 g/mol. IUPAC name: 2-[[3-hydroxy-1-oxo-1-(pyridin-2-ylamino)but-2-en-2-yl]diazenyl]benzoic acid. InChIKey: POMSQYBRHUFFDO-UHFFFAOYSA-N.

Identity
Molecular formulaC16H14N4O4
Molecular weight326.31 g/mol
IUPAC name2-[[3-hydroxy-1-oxo-1-(pyridin-2-ylamino)but-2-en-2-yl]diazenyl]benzoic acid
InChIKeyPOMSQYBRHUFFDO-UHFFFAOYSA-N
SMILESCC(=C(C(=O)NC1=CC=CC=N1)N=NC2=CC=CC=C2C(=O)O)O

Computed by PubChem (NCBI)