Products 229615-00-3
CAS 229615-00-3 is the registry number for Peramivir Impurity 35. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4R)-3-[(1S)-1-acetamido-2-ethylbutyl]-4-aminocyclopentene-1-carboxylic acid (CAS 229615-00-3) is a chemical compound with the molecular formula C14H24N2O3 and a molecular weight of 268.35 g/mol. IUPAC name: (3R,4R)-3-[(1S)-1-acetamido-2-ethylbutyl]-4-aminocyclopentene-1-carboxylic acid. InChIKey: RRSJICZPRPOEKB-UPJWGTAASA-N.
| Molecular formula | C14H24N2O3 |
|---|---|
| Molecular weight | 268.35 g/mol |
| IUPAC name | (3R,4R)-3-[(1S)-1-acetamido-2-ethylbutyl]-4-aminocyclopentene-1-carboxylic acid |
| InChIKey | RRSJICZPRPOEKB-UPJWGTAASA-N |
| SMILES | CCC(CC)[C@@H]([C@@H]1C=C(C[C@H]1N)C(=O)O)NC(=O)C |
Computed by PubChem (NCBI)