CAS 229615-05-8 appears in our catalog under these names: Peramivir Impurity 6 , Peramivir Impurity 38. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (1S,2S,3R,4R)-3-[(1R)-1-acetamido-2-ethylbutyl]-4-amino-2-hydroxycyclopentane-1-carboxylate (CAS 229615-05-8) is a chemical compound with the molecular formula C15H28N2O4 and a molecular weight of 300.39 g/mol. IUPAC name: methyl (1S,2S,3R,4R)-3-[(1R)-1-acetamido-2-ethylbutyl]-4-amino-2-hydroxycyclopentane-1-carboxylate. InChIKey: BITAQLVHEHUINR-RYMFRWLXSA-N.
| Molecular formula | C15H28N2O4 |
|---|---|
| Molecular weight | 300.39 g/mol |
| IUPAC name | methyl (1S,2S,3R,4R)-3-[(1R)-1-acetamido-2-ethylbutyl]-4-amino-2-hydroxycyclopentane-1-carboxylate |
| InChIKey | BITAQLVHEHUINR-RYMFRWLXSA-N |
| SMILES | CCC(CC)[C@H]([C@H]1[C@@H](C[C@@H]([C@H]1O)C(=O)OC)N)NC(=O)C |
Computed by PubChem (NCBI)