CAS 1821804-11-8 appears in our catalog under these names: (R)-Di-tert-butyl 2-methylpiperazine-1,4-dicarboxylate, 95%, (R)-Di-tert-butyl 2-methylpiperazine-1,4-dicarboxylate, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
Ditert-butyl (2R)-2-methylpiperazine-1,4-dicarboxylate (CAS 1821804-11-8) is a chemical compound with the molecular formula C15H28N2O4 and a molecular weight of 300.39 g/mol. IUPAC name: ditert-butyl (2R)-2-methylpiperazine-1,4-dicarboxylate. InChIKey: IMKNVNIIMKCRIO-LLVKDONJSA-N.
| Molecular formula | C15H28N2O4 |
|---|---|
| Molecular weight | 300.39 g/mol |
| IUPAC name | ditert-butyl (2R)-2-methylpiperazine-1,4-dicarboxylate |
| InChIKey | IMKNVNIIMKCRIO-LLVKDONJSA-N |
| SMILES | C[C@@H]1CN(CCN1C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)