CAS 22966-25-2 appears in our catalog under these names: (E)-1-(4-Fluorophenyl)-3-phenylprop-2-en-1-one 98%, (E)-1-(4-Fluorophenyl)-3-phenylprop-2-en-1-one, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g.
(E)-1-(4-fluorophenyl)-3-phenylprop-2-en-1-one (CAS 22966-25-2) is a chemical compound with the molecular formula C15H11FO and a molecular weight of 226.24 g/mol. IUPAC name: (E)-1-(4-fluorophenyl)-3-phenylprop-2-en-1-one. InChIKey: VKNQSJQWRINEFS-IZZDOVSWSA-N.
| Molecular formula | C15H11FO |
|---|---|
| Molecular weight | 226.24 g/mol |
| IUPAC name | (E)-1-(4-fluorophenyl)-3-phenylprop-2-en-1-one |
| InChIKey | VKNQSJQWRINEFS-IZZDOVSWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)