CAS 543741-44-2 is the registry number for 8-Fluoro-5h-dibenzo[a,d][7]annulen-10(11h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-fluorotricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-9-one (CAS 543741-44-2) is a chemical compound with the molecular formula C15H11FO and a molecular weight of 226.24 g/mol. IUPAC name: 6-fluorotricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-9-one. InChIKey: IVYDJPXELKPRQB-UHFFFAOYSA-N.
| Molecular formula | C15H11FO |
|---|---|
| Molecular weight | 226.24 g/mol |
| IUPAC name | 6-fluorotricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-9-one |
| InChIKey | IVYDJPXELKPRQB-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)F)C(=O)CC3=CC=CC=C31 |
Computed by PubChem (NCBI)