Products 2297-24-7

CAS 2297-24-7 is the registry number for 4-Methoxybenzenesulfonyl bromide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

4-methoxybenzenesulfonyl bromide (CAS 2297-24-7) is a chemical compound with the molecular formula C7H7BrO3S and a molecular weight of 251.10 g/mol. IUPAC name: 4-methoxybenzenesulfonyl bromide. InChIKey: YSFCREAOVCDYCH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7BrO3S
Molecular weight251.10 g/mol
IUPAC name4-methoxybenzenesulfonyl bromide
InChIKeyYSFCREAOVCDYCH-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)S(=O)(=O)Br

Computed by PubChem (NCBI)