CAS 2297-24-7 is the registry number for 4-Methoxybenzenesulfonyl bromide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
4-methoxybenzenesulfonyl bromide (CAS 2297-24-7) is a chemical compound with the molecular formula C7H7BrO3S and a molecular weight of 251.10 g/mol. IUPAC name: 4-methoxybenzenesulfonyl bromide. InChIKey: YSFCREAOVCDYCH-UHFFFAOYSA-N.
| Molecular formula | C7H7BrO3S |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | 4-methoxybenzenesulfonyl bromide |
| InChIKey | YSFCREAOVCDYCH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)S(=O)(=O)Br |
Computed by PubChem (NCBI)