CAS 88041-67-2 appears in our catalog under these names: 4–Bromo–2–methanesulfonylphenol, 4-Bromo-2-methanesulfonylphenol, 95%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 5g, 10g, 1g, 25g.
4-bromo-2-methylsulfonylphenol (CAS 88041-67-2) is a chemical compound with the molecular formula C7H7BrO3S and a molecular weight of 251.10 g/mol. IUPAC name: 4-bromo-2-methylsulfonylphenol. InChIKey: NUPADVWWKRDWOA-UHFFFAOYSA-N.
| Molecular formula | C7H7BrO3S |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | 4-bromo-2-methylsulfonylphenol |
| InChIKey | NUPADVWWKRDWOA-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=CC(=C1)Br)O |
Computed by PubChem (NCBI)