Products 2298-13-7
CAS 2298-13-7 appears in our catalog under these names: 2–Aminoazotoluene Hydrochloride, (E)-2-methyl-4-(o-tolyldiazenyl)aniline hydrochloride, >98.0%(T). Offered by: GLPBio, Fluorochem. Available pack sizes: 100g, 25g, 5g.
2-methyl-4-[(2-methylphenyl)diazenyl]aniline;hydrochloride (CAS 2298-13-7) is a chemical compound with the molecular formula C14H16ClN3 and a molecular weight of 261.75 g/mol. IUPAC name: 2-methyl-4-[(2-methylphenyl)diazenyl]aniline;hydrochloride. InChIKey: PUDCZUQFOPHIGU-UHFFFAOYSA-N.
| Molecular formula | C14H16ClN3 |
|---|---|
| Molecular weight | 261.75 g/mol |
| IUPAC name | 2-methyl-4-[(2-methylphenyl)diazenyl]aniline;hydrochloride |
| InChIKey | PUDCZUQFOPHIGU-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1N=NC2=CC(=C(C=C2)N)C.Cl |
Computed by PubChem (NCBI)