Products 230615-24-4
CAS 230615-24-4 is the registry number for 8-Methyl Varenicline Hydrochloride. Offered by: TRC. Available pack sizes: 50mg.
14-methyl-5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaene;hydrochloride (CAS 230615-24-4) is a chemical compound with the molecular formula C14H16ClN3 and a molecular weight of 261.75 g/mol. IUPAC name: 14-methyl-5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaene;hydrochloride. InChIKey: IPBMEWRYCHCXHC-UHFFFAOYSA-N.
| Molecular formula | C14H16ClN3 |
|---|---|
| Molecular weight | 261.75 g/mol |
| IUPAC name | 14-methyl-5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaene;hydrochloride |
| InChIKey | IPBMEWRYCHCXHC-UHFFFAOYSA-N |
| SMILES | CN1CC2CC(C1)C3=CC4=NC=CN=C4C=C23.Cl |
Computed by PubChem (NCBI)
Synonyms:
8-Methyl Varenicline Hydrochloride