CAS 2298-29-5 is the registry number for 3-(4-Hydroxyphenyl)-1-phenylurea. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
1-(4-hydroxyphenyl)-3-phenylurea (CAS 2298-29-5) is a chemical compound with the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. IUPAC name: 1-(4-hydroxyphenyl)-3-phenylurea. InChIKey: BNIXCWKOADUVSB-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2 |
|---|---|
| Molecular weight | 228.25 g/mol |
| IUPAC name | 1-(4-hydroxyphenyl)-3-phenylurea |
| InChIKey | BNIXCWKOADUVSB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)NC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)