CAS 2298453-14-0 is the registry number for tert-Butyl 4-chloro-3,3-difluoropyrrolidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-chloro-3,3-difluoropyrrolidine-1-carboxylate (CAS 2298453-14-0) is a chemical compound with the molecular formula C9H14ClF2NO2 and a molecular weight of 241.66 g/mol. IUPAC name: tert-butyl 4-chloro-3,3-difluoropyrrolidine-1-carboxylate. InChIKey: CTCMXWIKSNTNKW-UHFFFAOYSA-N.
| Molecular formula | C9H14ClF2NO2 |
|---|---|
| Molecular weight | 241.66 g/mol |
| IUPAC name | tert-butyl 4-chloro-3,3-difluoropyrrolidine-1-carboxylate |
| InChIKey | CTCMXWIKSNTNKW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C(C1)(F)F)Cl |
Computed by PubChem (NCBI)