CAS 2361644-03-1 is the registry number for Methyl 2-amino-6,6-difluorospiro(3.3)heptane-2-carboxylate hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 6-amino-2,2-difluorospiro[3.3]heptane-6-carboxylate;hydrochloride (CAS 2361644-03-1) is a chemical compound with the molecular formula C9H14ClF2NO2 and a molecular weight of 241.66 g/mol. IUPAC name: methyl 6-amino-2,2-difluorospiro[3.3]heptane-6-carboxylate;hydrochloride. InChIKey: DCDBKFWVTZFEBK-UHFFFAOYSA-N.
| Molecular formula | C9H14ClF2NO2 |
|---|---|
| Molecular weight | 241.66 g/mol |
| IUPAC name | methyl 6-amino-2,2-difluorospiro[3.3]heptane-6-carboxylate;hydrochloride |
| InChIKey | DCDBKFWVTZFEBK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CC2(C1)CC(C2)(F)F)N.Cl |
Computed by PubChem (NCBI)