Products 22991-05-5
CAS 22991-05-5 appears in our catalog under these names: 4-(3-Chlorophenyl)butanoic acid, 95%, 95%, 4-(3-Chlorophenyl)butanoic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
2-(3-chlorophenyl)butanoic acid (CAS 22991-05-5) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: 2-(3-chlorophenyl)butanoic acid. InChIKey: MLUSBOPUEWAMEK-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | 2-(3-chlorophenyl)butanoic acid |
| InChIKey | MLUSBOPUEWAMEK-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC(=CC=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)