Products 2301068-52-8

CAS 2301068-52-8 is the registry number for 4-Ethynyl-2-trifluoromethoxy-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Methyl 4-ethynyl-2-(trifluoromethoxy)benzoate (CAS 2301068-52-8) is a chemical compound with the molecular formula C11H7F3O3 and a molecular weight of 244.17 g/mol. IUPAC name: methyl 4-ethynyl-2-(trifluoromethoxy)benzoate. InChIKey: OMFKTJGJFJUCBB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7F3O3
Molecular weight244.17 g/mol
IUPAC namemethyl 4-ethynyl-2-(trifluoromethoxy)benzoate
InChIKeyOMFKTJGJFJUCBB-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=C(C=C1)C#C)OC(F)(F)F

Computed by PubChem (NCBI)