CAS 76579-48-1 is the registry number for 7-(2,2,2-Trifluoroethoxy)-2H-chromen-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-(2,2,2-trifluoroethoxy)chromen-2-one (CAS 76579-48-1) is a chemical compound with the molecular formula C11H7F3O3 and a molecular weight of 244.17 g/mol. IUPAC name: 7-(2,2,2-trifluoroethoxy)chromen-2-one. InChIKey: PNOSORGAWOJCAG-UHFFFAOYSA-N.
| Molecular formula | C11H7F3O3 |
|---|---|
| Molecular weight | 244.17 g/mol |
| IUPAC name | 7-(2,2,2-trifluoroethoxy)chromen-2-one |
| InChIKey | PNOSORGAWOJCAG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=O)O2)OCC(F)(F)F |
Computed by PubChem (NCBI)