CAS 2301881-22-9 is the registry number for Ethyl (1R,3R,5R)-2-azabicyclo[3.1.0]hexane-3-carboxylate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (1R,3R,5R)-2-azabicyclo[3.1.0]hexane-3-carboxylate;hydrochloride (CAS 2301881-22-9) is a chemical compound with the molecular formula C8H14ClNO2 and a molecular weight of 191.65 g/mol. IUPAC name: ethyl (1R,3R,5R)-2-azabicyclo[3.1.0]hexane-3-carboxylate;hydrochloride. InChIKey: AGIZNGQFIKFPKI-RYLOHDEPSA-N.
| Molecular formula | C8H14ClNO2 |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | ethyl (1R,3R,5R)-2-azabicyclo[3.1.0]hexane-3-carboxylate;hydrochloride |
| InChIKey | AGIZNGQFIKFPKI-RYLOHDEPSA-N |
| SMILES | CCOC(=O)[C@H]1C[C@H]2C[C@H]2N1.Cl |
Computed by PubChem (NCBI)