CAS 2301881-47-8 is the registry number for (R)-1-(4-Chloro-2,5-difluorophenyl)ethan-1-amine hydrochloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(4-chloro-2,5-difluorophenyl)ethanamine;hydrochloride (CAS 2301881-47-8) is a chemical compound with the molecular formula C8H9Cl2F2N and a molecular weight of 228.06 g/mol. IUPAC name: (1R)-1-(4-chloro-2,5-difluorophenyl)ethanamine;hydrochloride. InChIKey: MGAJMUHZWHARJZ-PGMHMLKASA-N.
| Molecular formula | C8H9Cl2F2N |
|---|---|
| Molecular weight | 228.06 g/mol |
| IUPAC name | (1R)-1-(4-chloro-2,5-difluorophenyl)ethanamine;hydrochloride |
| InChIKey | MGAJMUHZWHARJZ-PGMHMLKASA-N |
| SMILES | C[C@H](C1=CC(=C(C=C1F)Cl)F)N.Cl |
Computed by PubChem (NCBI)