Products 2931877-85-7
CAS 2931877-85-7 is the registry number for (R)-1-(4-Chlorophenyl)-2,2-difluoroethan-1-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(4-chlorophenyl)-2,2-difluoroethanamine;hydrochloride (CAS 2931877-85-7) is a chemical compound with the molecular formula C8H9Cl2F2N and a molecular weight of 228.06 g/mol. IUPAC name: (1R)-1-(4-chlorophenyl)-2,2-difluoroethanamine;hydrochloride. InChIKey: BAMMPMBLOBLIOU-OGFXRTJISA-N.
| Molecular formula | C8H9Cl2F2N |
|---|---|
| Molecular weight | 228.06 g/mol |
| IUPAC name | (1R)-1-(4-chlorophenyl)-2,2-difluoroethanamine;hydrochloride |
| InChIKey | BAMMPMBLOBLIOU-OGFXRTJISA-N |
| SMILES | C1=CC(=CC=C1[C@H](C(F)F)N)Cl.Cl |
Computed by PubChem (NCBI)