CAS 23037-64-1 is the registry number for 1-(1,3-Dioxaindan-5-yl)-2-methylpropan-2-ol. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg.
1-(1,3-benzodioxol-5-yl)-2-methylpropan-2-ol (CAS 23037-64-1) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-2-methylpropan-2-ol. InChIKey: PBSGUUZLCSVFEC-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-2-methylpropan-2-ol |
| InChIKey | PBSGUUZLCSVFEC-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC2=C(C=C1)OCO2)O |
Computed by PubChem (NCBI)