CAS 2304583-98-8 appears in our catalog under these names: 5-Amino-1-Cbz-2-methylpiperidine hydrochloride, 96%, 5-AMINO-1-CBZ-2-METHYLPIPERIDINE HCL, 97%, benzyl 5-amino-2-methylpiperidine-1-carboxylate hydrochloride, 95%, 95%, Benzyl 5-amino-2-methylpiperidine-1-carboxylate hydrochloride, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
Benzyl 5-amino-2-methylpiperidine-1-carboxylate;hydrochloride (CAS 2304583-98-8) is a chemical compound with the molecular formula C14H21ClN2O2 and a molecular weight of 284.78 g/mol. IUPAC name: benzyl 5-amino-2-methylpiperidine-1-carboxylate;hydrochloride. InChIKey: QDXRLZBFPKVDHC-UHFFFAOYSA-N.
| Molecular formula | C14H21ClN2O2 |
|---|---|
| Molecular weight | 284.78 g/mol |
| IUPAC name | benzyl 5-amino-2-methylpiperidine-1-carboxylate;hydrochloride |
| InChIKey | QDXRLZBFPKVDHC-UHFFFAOYSA-N |
| SMILES | CC1CCC(CN1C(=O)OCC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)