CAS 2304748-30-7 is the registry number for (2-Amino-3-chloropyridin-4-yl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2-amino-3-chloro-4-pyridinyl)boronic acid (CAS 2304748-30-7) is a chemical compound with the molecular formula C5H6BClN2O2 and a molecular weight of 172.38 g/mol. IUPAC name: (2-amino-3-chloro-4-pyridinyl)boronic acid. InChIKey: OUYNSNVKRVETHC-UHFFFAOYSA-N.
| Molecular formula | C5H6BClN2O2 |
|---|---|
| Molecular weight | 172.38 g/mol |
| IUPAC name | (2-amino-3-chloro-4-pyridinyl)boronic acid |
| InChIKey | OUYNSNVKRVETHC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=NC=C1)N)Cl)(O)O |
Computed by PubChem (NCBI)