CAS 1354697-94-1 appears in our catalog under these names: (5–Amino–6–chloropyridin–3–yl)boronic acid, (5-Amino-6-chloropyridin-3-yl)boronic acid, 98%, 98%, (5-Amino-6-chloropyridin-3-yl)boronic acid, 98%, (5-Amino-6-chloropyridin-3-yl)boronic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg, 25g.
(5-amino-6-chloro-3-pyridinyl)boronic acid (CAS 1354697-94-1) is a chemical compound with the molecular formula C5H6BClN2O2 and a molecular weight of 172.38 g/mol. IUPAC name: (5-amino-6-chloro-3-pyridinyl)boronic acid. InChIKey: JJIYFSZDCVYXTR-UHFFFAOYSA-N.
| Molecular formula | C5H6BClN2O2 |
|---|---|
| Molecular weight | 172.38 g/mol |
| IUPAC name | (5-amino-6-chloro-3-pyridinyl)boronic acid |
| InChIKey | JJIYFSZDCVYXTR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)Cl)N)(O)O |
Computed by PubChem (NCBI)