CAS 2225180-10-7 is the registry number for 2–(Methyl–d3)–4–chloropyrimidine–5–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[4-chloro-2-(trideuteriomethyl)pyrimidin-5-yl]boronic acid (CAS 2225180-10-7) is a chemical compound with the molecular formula C5H6BClN2O2 and a molecular weight of 175.40 g/mol. IUPAC name: [4-chloro-2-(trideuteriomethyl)pyrimidin-5-yl]boronic acid. InChIKey: YETREQHXFXKEJB-FIBGUPNXSA-N.
| Molecular formula | C5H6BClN2O2 |
|---|---|
| Molecular weight | 175.40 g/mol |
| IUPAC name | [4-chloro-2-(trideuteriomethyl)pyrimidin-5-yl]boronic acid |
| InChIKey | YETREQHXFXKEJB-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=NC=C(C(=N1)Cl)B(O)O |
Computed by PubChem (NCBI)