CAS 2305-26-2 appears in our catalog under these names: cis–4–Cyclohexene–1,2–dicarboxylic Acid, cis-4-Cyclohexene-1,2-dicarboxylic acid, 98% , cis-4-Cyclohexene-1,2-dicarboxylic Acid, >98.0%(GC)(T), (1R,2S)-rel-Cyclohex-4-ene-1,2-dicarboxylic acid 98%, (1R,2S)-rel-Cyclohex-4-ene-1,2-dicarboxylic acid, 98%, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 500g, 25g, 100g, 1000g, 1kg.
(1R,2S)-cyclohex-4-ene-1,2-dicarboxylic acid (CAS 2305-26-2) is a chemical compound with the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. IUPAC name: (1R,2S)-cyclohex-4-ene-1,2-dicarboxylic acid. InChIKey: ILUAAIDVFMVTAU-OLQVQODUSA-N.
| Molecular formula | C8H10O4 |
|---|---|
| Molecular weight | 170.16 g/mol |
| IUPAC name | (1R,2S)-cyclohex-4-ene-1,2-dicarboxylic acid |
| InChIKey | ILUAAIDVFMVTAU-OLQVQODUSA-N |
| SMILES | C1C=CC[C@@H]([C@@H]1C(=O)O)C(=O)O |
Computed by PubChem (NCBI)