CAS 2305185-20-8 appears in our catalog under these names: (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(2H-indazol-3-yl)propanoic acid, 98%, Fmoc-Ala(2H-indazol-3-yl)-OH 95%. Offered by: AmBeed. Available pack sizes: 5g, 100mg, 250mg, 1g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2H-indazol-3-yl)propanoic acid (CAS 2305185-20-8) is a chemical compound with the molecular formula C25H21N3O4 and a molecular weight of 427.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2H-indazol-3-yl)propanoic acid. InChIKey: IUAVQBDMSPGWBA-QHCPKHFHSA-N.
| Molecular formula | C25H21N3O4 |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2H-indazol-3-yl)propanoic acid |
| InChIKey | IUAVQBDMSPGWBA-QHCPKHFHSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=C5C=CC=CC5=NN4)C(=O)O |
Computed by PubChem (NCBI)