Products 3012560-58-3
CAS 3012560-58-3 is the registry number for Fmoc-L-4-AzaTrp-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 100mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-pyrrolo[3,2-b]pyridin-3-yl)propanoic acid (CAS 3012560-58-3) is a chemical compound with the molecular formula C25H21N3O4 and a molecular weight of 427.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-pyrrolo[3,2-b]pyridin-3-yl)propanoic acid. InChIKey: PXSDGRSMKHSXAY-QFIPXVFZSA-N.
| Molecular formula | C25H21N3O4 |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-pyrrolo[3,2-b]pyridin-3-yl)propanoic acid |
| InChIKey | PXSDGRSMKHSXAY-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CNC5=C4N=CC=C5)C(=O)O |
Computed by PubChem (NCBI)