Products 2305251-72-1
CAS 2305251-72-1 is the registry number for 4,4-Dimethyl-3,5-dioxatricyclo(5.2.1.0,2,6)decane-8-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane-8-carboxylic acid (CAS 2305251-72-1) is a chemical compound with the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. IUPAC name: 4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane-8-carboxylic acid. InChIKey: UPTFOLCCJKRLIA-UHFFFAOYSA-N.
| Molecular formula | C11H16O4 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane-8-carboxylic acid |
| InChIKey | UPTFOLCCJKRLIA-UHFFFAOYSA-N |
| SMILES | CC1(OC2C3CC(C2O1)C(C3)C(=O)O)C |
Computed by PubChem (NCBI)