CAS 2305253-90-9 is the registry number for 5-{(Dimethyl(oxo)-λ6-sulfanylidene)amino}thiophene-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-[[dimethyl(oxo)-lambda6-sulfanylidene]amino]thiophene-2-carboxylic acid (CAS 2305253-90-9) is a chemical compound with the molecular formula C7H9NO3S2 and a molecular weight of 219.3 g/mol. IUPAC name: 5-[[dimethyl(oxo)-lambda6-sulfanylidene]amino]thiophene-2-carboxylic acid. InChIKey: WSDAFMGZZBPMIL-UHFFFAOYSA-N.
| Molecular formula | C7H9NO3S2 |
|---|---|
| Molecular weight | 219.3 g/mol |
| IUPAC name | 5-[[dimethyl(oxo)-lambda6-sulfanylidene]amino]thiophene-2-carboxylic acid |
| InChIKey | WSDAFMGZZBPMIL-UHFFFAOYSA-N |
| SMILES | CS(=NC1=CC=C(S1)C(=O)O)(=O)C |
Computed by PubChem (NCBI)