Products 2305255-02-9
CAS 2305255-02-9 is the registry number for 1-{((tert-Butoxy)carbonyl)amino}-3-tert-butylcyclobutane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-tert-butyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid (CAS 2305255-02-9) is a chemical compound with the molecular formula C14H25NO4 and a molecular weight of 271.35 g/mol. IUPAC name: 3-tert-butyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid. InChIKey: LRTCPDYXLJJFCR-UHFFFAOYSA-N.
| Molecular formula | C14H25NO4 |
|---|---|
| Molecular weight | 271.35 g/mol |
| IUPAC name | 3-tert-butyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid |
| InChIKey | LRTCPDYXLJJFCR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CC(C1)(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)