CAS 2305368-53-8 is the registry number for 3-(4-Methylphenyl)-4-(4-(methylsulfonyl)phenyl)-1-propyl-1H-pyrrol-2-ol . Offered by: TRC. Available pack sizes: 50mg.
3-(4-methylphenyl)-4-(4-methylsulfonylphenyl)-1-propylpyrrol-2-ol (CAS 2305368-53-8) is a chemical compound with the molecular formula C21H23NO3S and a molecular weight of 369.5 g/mol. IUPAC name: 3-(4-methylphenyl)-4-(4-methylsulfonylphenyl)-1-propylpyrrol-2-ol. InChIKey: QZCDEIDTIDADDX-UHFFFAOYSA-N.
| Molecular formula | C21H23NO3S |
|---|---|
| Molecular weight | 369.5 g/mol |
| IUPAC name | 3-(4-methylphenyl)-4-(4-methylsulfonylphenyl)-1-propylpyrrol-2-ol |
| InChIKey | QZCDEIDTIDADDX-UHFFFAOYSA-N |
| SMILES | CCCN1C=C(C(=C1O)C2=CC=C(C=C2)C)C3=CC=C(C=C3)S(=O)(=O)C |
Computed by PubChem (NCBI)