CAS 395683-14-4 appears in our catalog under these names: Imrecoxib, Imrecoxib/ 99.94% (existing batch purity), Imrecoxib 98+%, Imrecoxib, 98%, 98%, Imrecoxib, 99.95%. Offered by: Chemat Brand, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: on request, 25mg, 100mg, 250mg, 1g, 100 mg, 50 mg, 10mM/1mL.
4-(4-methylphenyl)-3-(4-methylsulfonylphenyl)-1-propyl-2H-pyrrol-5-one (CAS 395683-14-4) is a chemical compound with the molecular formula C21H23NO3S and a molecular weight of 369.5 g/mol. IUPAC name: 4-(4-methylphenyl)-3-(4-methylsulfonylphenyl)-1-propyl-2H-pyrrol-5-one. InChIKey: AXMZZGKKZDJGAZ-UHFFFAOYSA-N.
| Molecular formula | C21H23NO3S |
|---|---|
| Molecular weight | 369.5 g/mol |
| IUPAC name | 4-(4-methylphenyl)-3-(4-methylsulfonylphenyl)-1-propyl-2H-pyrrol-5-one |
| InChIKey | AXMZZGKKZDJGAZ-UHFFFAOYSA-N |
| SMILES | CCCN1CC(=C(C1=O)C2=CC=C(C=C2)C)C3=CC=C(C=C3)S(=O)(=O)C |
Computed by PubChem (NCBI)