Products 23057-98-9
CAS 23057-98-9 appears in our catalog under these names: Dimethyl Fumarate-2,3-d2, 98 atom % D, min 98% Chemical Purity, Dimethyl Fumarate-d2, >95% (HPLC), Dimethyl fumarate–d2, Dimethyl fumarate-d2, D2-Dimethyl fumarate, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: CDN, TRC, GLPBio, Biosynth, HPC Standards. Available pack sizes: 0,25g, 0,1g, 10mg, 25mg, 50mg, 5mg, 1x5ml, 1x10mg.
Dimethyl (E)-2,3-dideuteriobut-2-enedioate (CAS 23057-98-9) is a chemical compound with the molecular formula C6H8O4 and a molecular weight of 146.14 g/mol. IUPAC name: dimethyl (E)-2,3-dideuteriobut-2-enedioate. InChIKey: LDCRTTXIJACKKU-SWIHUIHJSA-N.
| Molecular formula | C6H8O4 |
|---|---|
| Molecular weight | 146.14 g/mol |
| IUPAC name | dimethyl (E)-2,3-dideuteriobut-2-enedioate |
| InChIKey | LDCRTTXIJACKKU-SWIHUIHJSA-N |
| SMILES | [2H]/C(=C(/[2H])\C(=O)OC)/C(=O)OC |
Computed by PubChem (NCBI)