Products 66487-95-4
CAS 66487-95-4 appears in our catalog under these names: Dimethyl Fumarate-d6, >95% (HPLC), Dimethyl Fumarate-d6, Dimethyl fumarate D6, Dimethyl fumarate-d6, 99.9%. Offered by: TRC, Chemat Brand, GLPBio, TargetMol, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, on request, 1mg, 5 mg, 1 mg, 10 mg.
Bis(trideuteriomethyl) (E)-but-2-enedioate (CAS 66487-95-4) is a chemical compound with the molecular formula C6H8O4 and a molecular weight of 150.16 g/mol. IUPAC name: bis(trideuteriomethyl) (E)-but-2-enedioate. InChIKey: LDCRTTXIJACKKU-XDMLVRQJSA-N.
| Molecular formula | C6H8O4 |
|---|---|
| Molecular weight | 150.16 g/mol |
| IUPAC name | bis(trideuteriomethyl) (E)-but-2-enedioate |
| InChIKey | LDCRTTXIJACKKU-XDMLVRQJSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)/C=C/C(=O)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)