CAS 2306217-14-9 is the registry number for Varenicline Impurity 26. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(1R,12S)-5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaen-14-yl]ethane-1,2-diol (CAS 2306217-14-9) is a chemical compound with the molecular formula C15H17N3O2 and a molecular weight of 271.31 g/mol. IUPAC name: 1-[(1R,12S)-5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaen-14-yl]ethane-1,2-diol. InChIKey: AZMSEUVYUPVBIY-WYPFBEBGSA-N.
| Molecular formula | C15H17N3O2 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 1-[(1R,12S)-5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaen-14-yl]ethane-1,2-diol |
| InChIKey | AZMSEUVYUPVBIY-WYPFBEBGSA-N |
| SMILES | C1[C@@H]2CN(C[C@H]1C3=CC4=NC=CN=C4C=C23)C(CO)O |
Computed by PubChem (NCBI)