Products 2270910-51-3
CAS 2270910-51-3 is the registry number for 2-[4-(3-Acetyl-phenyl)-pyrazol-1-yl]-n,n-dimethyl-acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-[4-(3-acetylphenyl)pyrazol-1-yl]-N,N-dimethylacetamide (CAS 2270910-51-3) is a chemical compound with the molecular formula C15H17N3O2 and a molecular weight of 271.31 g/mol. IUPAC name: 2-[4-(3-acetylphenyl)pyrazol-1-yl]-N,N-dimethylacetamide. InChIKey: GJXVHXXPLXGFPL-UHFFFAOYSA-N.
| Molecular formula | C15H17N3O2 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 2-[4-(3-acetylphenyl)pyrazol-1-yl]-N,N-dimethylacetamide |
| InChIKey | GJXVHXXPLXGFPL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=CC(=C1)C2=CN(N=C2)CC(=O)N(C)C |
Computed by PubChem (NCBI)