CAS 284462-89-1 is the registry number for Sorafenib Related Compound 22. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-aminophenoxy)-N-propan-2-ylpyridine-2-carboxamide (CAS 284462-89-1) is a chemical compound with the molecular formula C15H17N3O2 and a molecular weight of 271.31 g/mol. IUPAC name: 4-(4-aminophenoxy)-N-propan-2-ylpyridine-2-carboxamide. InChIKey: APOLNRVWFKLAKB-UHFFFAOYSA-N.
| Molecular formula | C15H17N3O2 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 4-(4-aminophenoxy)-N-propan-2-ylpyridine-2-carboxamide |
| InChIKey | APOLNRVWFKLAKB-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)C1=NC=CC(=C1)OC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)