CAS 2306244-83-5 is the registry number for tert-Butyl (((2R,4S)-4-hydroxypyrrolidin-2-yl)methyl)carbamate, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
Tert-butyl N-[[(2R,4S)-4-hydroxypyrrolidin-2-yl]methyl]carbamate (CAS 2306244-83-5) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl N-[[(2R,4S)-4-hydroxypyrrolidin-2-yl]methyl]carbamate. InChIKey: AEEDNTYVDBGMCS-SFYZADRCSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl N-[[(2R,4S)-4-hydroxypyrrolidin-2-yl]methyl]carbamate |
| InChIKey | AEEDNTYVDBGMCS-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@H]1C[C@@H](CN1)O |
Computed by PubChem (NCBI)