CAS 500733-24-4 appears in our catalog under these names: tert-Butyl N-{((2S,4R)-4-hydroxypyrrolidin-2-yl)methyl}carbamate, 97%, tert-butyl N-{[(2S,4R)-4-hydroxypyrrolidin-2-yl]methyl}carbamate, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g.
Tert-butyl N-[[(2S,4R)-4-hydroxypyrrolidin-2-yl]methyl]carbamate (CAS 500733-24-4) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl N-[[(2S,4R)-4-hydroxypyrrolidin-2-yl]methyl]carbamate. InChIKey: AEEDNTYVDBGMCS-JGVFFNPUSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl N-[[(2S,4R)-4-hydroxypyrrolidin-2-yl]methyl]carbamate |
| InChIKey | AEEDNTYVDBGMCS-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H]1C[C@H](CN1)O |
Computed by PubChem (NCBI)