CAS 2306245-33-8 is the registry number for 4-((3S,5R)-4-(tert-Butoxycarbonyl)-3,5-dimethylpiperazin-1-yl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(3R,5S)-3,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]benzoic acid (CAS 2306245-33-8) is a chemical compound with the molecular formula C18H26N2O4 and a molecular weight of 334.4 g/mol. IUPAC name: 4-[(3R,5S)-3,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]benzoic acid. InChIKey: KXPIRZTXDZABJC-BETUJISGSA-N.
| Molecular formula | C18H26N2O4 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 4-[(3R,5S)-3,5-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]benzoic acid |
| InChIKey | KXPIRZTXDZABJC-BETUJISGSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](N1C(=O)OC(C)(C)C)C)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)