Products 2306245-41-8
CAS 2306245-41-8 is the registry number for Ethyl (1R,3S,4R)-4-((tert-butoxycarbonyl)amino)-3-fluorocyclohexane-1-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Ethyl (1R,3S,4R)-3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate (CAS 2306245-41-8) is a chemical compound with the molecular formula C14H24FNO4 and a molecular weight of 289.34 g/mol. IUPAC name: ethyl (1R,3S,4R)-3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate. InChIKey: MJGYMQNPIIFHFQ-OUAUKWLOSA-N.
| Molecular formula | C14H24FNO4 |
|---|---|
| Molecular weight | 289.34 g/mol |
| IUPAC name | ethyl (1R,3S,4R)-3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate |
| InChIKey | MJGYMQNPIIFHFQ-OUAUKWLOSA-N |
| SMILES | CCOC(=O)[C@@H]1CC[C@H]([C@H](C1)F)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)