CAS 2639893-68-6 is the registry number for Di-tert-butyl (2S,4R)-4-fluoropyrrolidine-1,2-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ditert-butyl (2S,4R)-4-fluoropyrrolidine-1,2-dicarboxylate (CAS 2639893-68-6) is a chemical compound with the molecular formula C14H24FNO4 and a molecular weight of 289.34 g/mol. IUPAC name: ditert-butyl (2S,4R)-4-fluoropyrrolidine-1,2-dicarboxylate. InChIKey: YKHVGJVWBNTGCK-ZJUUUORDSA-N.
| Molecular formula | C14H24FNO4 |
|---|---|
| Molecular weight | 289.34 g/mol |
| IUPAC name | ditert-butyl (2S,4R)-4-fluoropyrrolidine-1,2-dicarboxylate |
| InChIKey | YKHVGJVWBNTGCK-ZJUUUORDSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@H](CN1C(=O)OC(C)(C)C)F |
Computed by PubChem (NCBI)